Products 1270869-72-1
CAS 1270869-72-1 is the registry number for 4-Amino-5-(5-methyl-1-benzofuran-2-yl)-4H-1,2,4-triazole-3-thiol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-amino-3-(5-methyl-1-benzofuran-2-yl)-1H-1,2,4-triazole-5-thione (CAS 1270869-72-1) is a chemical compound with the molecular formula C11H10N4OS and a molecular weight of 246.29 g/mol. IUPAC name: 4-amino-3-(5-methyl-1-benzofuran-2-yl)-1H-1,2,4-triazole-5-thione. InChIKey: CXFZPSOLQNRQHU-UHFFFAOYSA-N.
| Molecular formula | C11H10N4OS |
|---|---|
| Molecular weight | 246.29 g/mol |
| IUPAC name | 4-amino-3-(5-methyl-1-benzofuran-2-yl)-1H-1,2,4-triazole-5-thione |
| InChIKey | CXFZPSOLQNRQHU-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)OC(=C2)C3=NNC(=S)N3N |
Computed by PubChem (NCBI)