CAS 64232-83-3 appears in our catalog under these names: L189, L189/ 99.72% (existing batch purity), L189 98%, 4(1H)-Pyrimidinone, 6-amino-2,3-dihydro-5-[(phenylmethylene)amino]-2-thioxo-, 98%, 98%, L189, 98.0%. Offered by: TRC, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 10mg, 50mg, 5mg, 25mg, 100mg, 200mg, 10mM (in 1ml dmso), 1mg.
6-amino-5-(benzylideneamino)-2-sulfanylidene-1H-pyrimidin-4-one (CAS 64232-83-3) is a chemical compound with the molecular formula C11H10N4OS and a molecular weight of 246.29 g/mol. IUPAC name: 6-amino-5-(benzylideneamino)-2-sulfanylidene-1H-pyrimidin-4-one. InChIKey: SAKOXVNKDMWWLF-UHFFFAOYSA-N.
| Molecular formula | C11H10N4OS |
|---|---|
| Molecular weight | 246.29 g/mol |
| IUPAC name | 6-amino-5-(benzylideneamino)-2-sulfanylidene-1H-pyrimidin-4-one |
| InChIKey | SAKOXVNKDMWWLF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C=NC2=C(NC(=S)NC2=O)N |
Computed by PubChem (NCBI)