CAS 1270981-57-1 appears in our catalog under these names: 4-(Difluoromethyl)-2-fluorobenzoic acid, 95%, 4-(Difluoromethyl)-2-fluorobenzoic acid, 4-(Difluoromethyl)-2-fluorobenzoic acid, 95%, 95%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 0,5g, 50mg, 100mg, 250mg.
4-(difluoromethyl)-2-fluorobenzoic acid (CAS 1270981-57-1) is a chemical compound with the molecular formula C8H5F3O2 and a molecular weight of 190.12 g/mol. IUPAC name: 4-(difluoromethyl)-2-fluorobenzoic acid. InChIKey: LGLMIWMIGJDPNZ-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O2 |
|---|---|
| Molecular weight | 190.12 g/mol |
| IUPAC name | 4-(difluoromethyl)-2-fluorobenzoic acid |
| InChIKey | LGLMIWMIGJDPNZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)F)F)C(=O)O |
Computed by PubChem (NCBI)