CAS 127168-83-6 is the registry number for 4-Bromo-2-tosylisoindoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindole (CAS 127168-83-6) is a chemical compound with the molecular formula C15H14BrNO2S and a molecular weight of 352.2 g/mol. IUPAC name: 4-bromo-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindole. InChIKey: UFMXWSAEFIMVKC-UHFFFAOYSA-N.
| Molecular formula | C15H14BrNO2S |
|---|---|
| Molecular weight | 352.2 g/mol |
| IUPAC name | 4-bromo-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindole |
| InChIKey | UFMXWSAEFIMVKC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC3=C(C2)C(=CC=C3)Br |
Computed by PubChem (NCBI)