CAS 1715931-86-4 is the registry number for N-(1-(3-Bromophenyl)ethylidene)-4-methylbenzenesulfonamide. Offered by: TRC. Available pack sizes: 2,5g.
N-[1-(3-bromophenyl)ethylidene]-4-methylbenzenesulfonamide (CAS 1715931-86-4) is a chemical compound with the molecular formula C15H14BrNO2S and a molecular weight of 352.2 g/mol. IUPAC name: N-[1-(3-bromophenyl)ethylidene]-4-methylbenzenesulfonamide. InChIKey: JQQKBYQVHGIDNB-UHFFFAOYSA-N.
| Molecular formula | C15H14BrNO2S |
|---|---|
| Molecular weight | 352.2 g/mol |
| IUPAC name | N-[1-(3-bromophenyl)ethylidene]-4-methylbenzenesulfonamide |
| InChIKey | JQQKBYQVHGIDNB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N=C(C)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)