CAS 127201-42-7 is the registry number for 3-(Dimethylamino)-N-methylbenzamide. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3-(dimethylamino)-N-methylbenzamide (CAS 127201-42-7) is a chemical compound with the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. IUPAC name: 3-(dimethylamino)-N-methylbenzamide. InChIKey: WGQJWLOSLGAFHD-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 3-(dimethylamino)-N-methylbenzamide |
| InChIKey | WGQJWLOSLGAFHD-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC(=CC=C1)N(C)C |
Computed by PubChem (NCBI)