Products 1272090-24-0

CAS 1272090-24-0 is the registry number for 2-(3-Bromo-5-fluorophenyl)-5-methyloxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(3-bromo-5-fluorophenyl)-5-methyl-1,3-oxazole-4-carboxylic acid (CAS 1272090-24-0) is a chemical compound with the molecular formula C11H7BrFNO3 and a molecular weight of 300.08 g/mol. IUPAC name: 2-(3-bromo-5-fluorophenyl)-5-methyl-1,3-oxazole-4-carboxylic acid. InChIKey: YHQYUVWWGIXLIG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7BrFNO3
Molecular weight300.08 g/mol
IUPAC name2-(3-bromo-5-fluorophenyl)-5-methyl-1,3-oxazole-4-carboxylic acid
InChIKeyYHQYUVWWGIXLIG-UHFFFAOYSA-N
SMILESCC1=C(N=C(O1)C2=CC(=CC(=C2)Br)F)C(=O)O

Computed by PubChem (NCBI)