CAS 334971-46-9 is the registry number for 3-(4-Bromo-2-fluorophenyl)-5-methylisoxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-bromo-2-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 334971-46-9) is a chemical compound with the molecular formula C11H7BrFNO3 and a molecular weight of 300.08 g/mol. IUPAC name: 3-(4-bromo-2-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: HWJGMFHETXFQCA-UHFFFAOYSA-N.
| Molecular formula | C11H7BrFNO3 |
|---|---|
| Molecular weight | 300.08 g/mol |
| IUPAC name | 3-(4-bromo-2-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | HWJGMFHETXFQCA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=C(C=C(C=C2)Br)F)C(=O)O |
Computed by PubChem (NCBI)