Products 127245-22-1
CAS 127245-22-1 appears in our catalog under these names: Biofor 389/ 99.47% (existing batch purity), 4-[[3,5-Bis(1,1-dimethylethyl)-4-hydroxyphenyl]methylene]dihydro-2-methyl-2H-1,2-oxazin-3(4H)-one, BF389. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1 mg, 5 mg.
(4E)-4-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-2-methyloxazinan-3-one (CAS 127245-22-1) is a chemical compound with the molecular formula C20H29NO3 and a molecular weight of 331.4 g/mol. IUPAC name: (4E)-4-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-2-methyloxazinan-3-one. InChIKey: BWRYNNCGEDOTRW-GXDHUFHOSA-N.
| Molecular formula | C20H29NO3 |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | (4E)-4-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-2-methyloxazinan-3-one |
| InChIKey | BWRYNNCGEDOTRW-GXDHUFHOSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)/C=C/2\CCON(C2=O)C |
Computed by PubChem (NCBI)