Products 127266-13-1

CAS 127266-13-1 is the registry number for Tiaprofenic Acid Ethyl Ester. Offered by: Mikromol. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(5-benzoylthiophen-2-yl)propanoate (CAS 127266-13-1) is a chemical compound with the molecular formula C16H16O3S and a molecular weight of 288.4 g/mol. IUPAC name: ethyl 2-(5-benzoylthiophen-2-yl)propanoate. InChIKey: QEAPFNKKTWXFDJ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H16O3S
Molecular weight288.4 g/mol
IUPAC nameethyl 2-(5-benzoylthiophen-2-yl)propanoate
InChIKeyQEAPFNKKTWXFDJ-UHFFFAOYSA-N
SMILESCCOC(=O)C(C)C1=CC=C(S1)C(=O)C2=CC=CC=C2

Computed by PubChem (NCBI)