CAS 127266-13-1 is the registry number for Tiaprofenic Acid Ethyl Ester. Offered by: Mikromol. Available pack sizes: 100mg.
Ethyl 2-(5-benzoylthiophen-2-yl)propanoate (CAS 127266-13-1) is a chemical compound with the molecular formula C16H16O3S and a molecular weight of 288.4 g/mol. IUPAC name: ethyl 2-(5-benzoylthiophen-2-yl)propanoate. InChIKey: QEAPFNKKTWXFDJ-UHFFFAOYSA-N.
| Molecular formula | C16H16O3S |
|---|---|
| Molecular weight | 288.4 g/mol |
| IUPAC name | ethyl 2-(5-benzoylthiophen-2-yl)propanoate |
| InChIKey | QEAPFNKKTWXFDJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)C1=CC=C(S1)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)