CAS 1097016-69-7 appears in our catalog under these names: (2,5-Dimethylphenyl)(3-methanesulfonylphenyl)methanone, 95%, (2,5-Dimethylphenyl)(3-methanesulfonylphenyl)methanone. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
(2,5-dimethylphenyl)-(3-methylsulfonylphenyl)methanone (CAS 1097016-69-7) is a chemical compound with the molecular formula C16H16O3S and a molecular weight of 288.4 g/mol. IUPAC name: (2,5-dimethylphenyl)-(3-methylsulfonylphenyl)methanone. InChIKey: NYEIHCJWJSZNGM-UHFFFAOYSA-N.
| Molecular formula | C16H16O3S |
|---|---|
| Molecular weight | 288.4 g/mol |
| IUPAC name | (2,5-dimethylphenyl)-(3-methylsulfonylphenyl)methanone |
| InChIKey | NYEIHCJWJSZNGM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)C(=O)C2=CC(=CC=C2)S(=O)(=O)C |
Computed by PubChem (NCBI)