CAS 1272755-74-4 is the registry number for Fmoc–D–Thr–OH·H2O. Offered by: GLPBio. Available pack sizes: 25g, 5g.
(2R,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybutanoic acid;hydrate (CAS 1272755-74-4) is a chemical compound with the molecular formula C19H21NO6 and a molecular weight of 359.4 g/mol. IUPAC name: (2R,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybutanoic acid;hydrate. InChIKey: CGNQPFAECJFQNV-VFZPIINCSA-N.
| Molecular formula | C19H21NO6 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | (2R,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybutanoic acid;hydrate |
| InChIKey | CGNQPFAECJFQNV-VFZPIINCSA-N |
| SMILES | C[C@@H]([C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)O.O |
Computed by PubChem (NCBI)