CAS 229957-49-7 appears in our catalog under these names: Fmoc-l-threonine monohydrate, 98%, (2S,3R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-hydroxybutanoic acid hydrate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 500g, 100g, 25g.
(2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybutanoic acid;hydrate (CAS 229957-49-7) is a chemical compound with the molecular formula C19H21NO6 and a molecular weight of 359.4 g/mol. IUPAC name: (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybutanoic acid;hydrate. InChIKey: CGNQPFAECJFQNV-NRNQBQMASA-N.
| Molecular formula | C19H21NO6 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybutanoic acid;hydrate |
| InChIKey | CGNQPFAECJFQNV-NRNQBQMASA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)O.O |
Computed by PubChem (NCBI)