CAS 1273-89-8 appears in our catalog under these names: Ethylferrocene, 95%, Ethylferrocene, Ethyl ferrocene, Î"²-iron(2+) 3-ethylcyclopenta-2,4-dien-1-ide cyclopenta-2,4-dien-1-ide, 98%. Offered by: Chemat Brand, GLPBio, Biosynth, Fluorochem. Available pack sizes: on request, 25g, 5g, 10g, 1g.
CAS 1273-89-8 identifies a chemical compound with the molecular formula C12H14Fe and a molecular weight of 214.08 g/mol. InChIKey: XEYMPZDIHJESAH-UHFFFAOYSA-N.
| Molecular formula | C12H14Fe |
|---|---|
| Molecular weight | 214.08 g/mol |
| InChIKey | XEYMPZDIHJESAH-UHFFFAOYSA-N |
| SMILES | CC[C]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe] |
Computed by PubChem (NCBI)