CAS 1291-47-0 appears in our catalog under these names: 1,1'–Dimethylferrocene, 1,1'-Dimethylferrocene/ 98%, 1,1'-Dimethylferrocene, 97% , 1,1'-Dimethylferrocene, >93.0%(GC), 1,1'-Dimethylferrocene 98%. Offered by: GLPBio, Chemat, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 25g, 5g, 1g, 100g, 10g.
CAS 1291-47-0 identifies a chemical compound with the molecular formula C12H14Fe and a molecular weight of 214.08 g/mol. InChIKey: GJFIEPAJMYPAGC-UHFFFAOYSA-N.
| Molecular formula | C12H14Fe |
|---|---|
| Molecular weight | 214.08 g/mol |
| InChIKey | GJFIEPAJMYPAGC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C[CH]1.CC1=CC=C[CH]1.[Fe] |
Computed by PubChem (NCBI)