CAS 127345-12-4 is the registry number for Crotamiton Impurity 14. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-N-methyl-N-(2-methylphenyl)but-2-enamide (CAS 127345-12-4) is a chemical compound with the molecular formula C12H15NO and a molecular weight of 189.25 g/mol. IUPAC name: (E)-N-methyl-N-(2-methylphenyl)but-2-enamide. InChIKey: QKTYAHSIJAZBSB-QPJJXVBHSA-N.
| Molecular formula | C12H15NO |
|---|---|
| Molecular weight | 189.25 g/mol |
| IUPAC name | (E)-N-methyl-N-(2-methylphenyl)but-2-enamide |
| InChIKey | QKTYAHSIJAZBSB-QPJJXVBHSA-N |
| SMILES | C/C=C/C(=O)N(C)C1=CC=CC=C1C |
Computed by PubChem (NCBI)