Products 1273565-93-7
CAS 1273565-93-7 is the registry number for 5H-Furo[2,3-c]pyrrole-5-carboxylic acid, 3-(aminomethyl)hexahydro-, 1,1-dimethylethyl ester, (3R,3aR,6aR)-rel-, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3S,3aS,6aS)-3-(aminomethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-5-carboxylate (CAS 1273565-93-7) is a chemical compound with the molecular formula C12H22N2O3 and a molecular weight of 242.31 g/mol. IUPAC name: tert-butyl (3S,3aS,6aS)-3-(aminomethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-5-carboxylate. InChIKey: SCNZIMGXJYWNJL-IVZWLZJFSA-N.
| Molecular formula | C12H22N2O3 |
|---|---|
| Molecular weight | 242.31 g/mol |
| IUPAC name | tert-butyl (3S,3aS,6aS)-3-(aminomethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-5-carboxylate |
| InChIKey | SCNZIMGXJYWNJL-IVZWLZJFSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2[C@@H](C1)OC[C@@H]2CN |
Computed by PubChem (NCBI)