CAS 1251021-54-1 appears in our catalog under these names: Octahydropyrido[3,4-b][1,4]oxazine-6-carboxylic acid tert-butyl ester, 95%, trans-tert-Butyl hexahydro-1H-pyrido(3,4-b)(1,4)oxazine-6(7H)-carboxylate, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Tert-butyl (4aR,8aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazine-6-carboxylate (CAS 1251021-54-1) is a chemical compound with the molecular formula C12H22N2O3 and a molecular weight of 242.31 g/mol. IUPAC name: tert-butyl (4aR,8aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazine-6-carboxylate. InChIKey: COJUSTWUQICURS-NXEZZACHSA-N.
| Molecular formula | C12H22N2O3 |
|---|---|
| Molecular weight | 242.31 g/mol |
| IUPAC name | tert-butyl (4aR,8aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazine-6-carboxylate |
| InChIKey | COJUSTWUQICURS-NXEZZACHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]2[C@@H](C1)OCCN2 |
Computed by PubChem (NCBI)