Products 1251006-15-1
CAS 1251006-15-1 is the registry number for Cis-octahydro-4-oxa-2,7-diaza-azulene-2-carboxylic acidtert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl (5aS,8aS)-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-f][1,4]oxazepine-7-carboxylate (CAS 1251006-15-1) is a chemical compound with the molecular formula C12H22N2O3 and a molecular weight of 242.31 g/mol. IUPAC name: tert-butyl (5aS,8aS)-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-f][1,4]oxazepine-7-carboxylate. InChIKey: XAZLYQXWLXXDDU-VHSXEESVSA-N.
| Molecular formula | C12H22N2O3 |
|---|---|
| Molecular weight | 242.31 g/mol |
| IUPAC name | tert-butyl (5aS,8aS)-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-f][1,4]oxazepine-7-carboxylate |
| InChIKey | XAZLYQXWLXXDDU-VHSXEESVSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CNCCO[C@@H]2C1 |
Computed by PubChem (NCBI)