CAS 1273577-17-5 appears in our catalog under these names: 3-Bromopyrazolo[1,5-a]pyrimidin-7-amine, 97%, 97%, 3-Bromopyrazolo[1,5-a]pyrimidin-7-amine, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3-bromopyrazolo[1,5-a]pyrimidin-7-amine (CAS 1273577-17-5) is a chemical compound with the molecular formula C6H5BrN4 and a molecular weight of 213.03 g/mol. IUPAC name: 3-bromopyrazolo[1,5-a]pyrimidin-7-amine. InChIKey: IJLDEPNFJQGNGY-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN4 |
|---|---|
| Molecular weight | 213.03 g/mol |
| IUPAC name | 3-bromopyrazolo[1,5-a]pyrimidin-7-amine |
| InChIKey | IJLDEPNFJQGNGY-UHFFFAOYSA-N |
| SMILES | C1=C(N2C(=C(C=N2)Br)N=C1)N |
Computed by PubChem (NCBI)