Products 1273585-10-6
CAS 1273585-10-6 is the registry number for 3-Chloro-5-fluoro-4-nitrobenzonitrile, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
3-chloro-5-fluoro-4-nitrobenzonitrile (CAS 1273585-10-6) is a chemical compound with the molecular formula C7H2ClFN2O2 and a molecular weight of 200.55 g/mol. IUPAC name: 3-chloro-5-fluoro-4-nitrobenzonitrile. InChIKey: PNMZVEHEOIYSLE-UHFFFAOYSA-N.
| Molecular formula | C7H2ClFN2O2 |
|---|---|
| Molecular weight | 200.55 g/mol |
| IUPAC name | 3-chloro-5-fluoro-4-nitrobenzonitrile |
| InChIKey | PNMZVEHEOIYSLE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)[N+](=O)[O-])Cl)C#N |
Computed by PubChem (NCBI)