CAS 1380921-45-8 appears in our catalog under these names: 4-Chloro-3-fluoro-5-nitrobenzonitrile, 95%, 4-Chloro-3-fluoro-5-nitrobenzonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
4-chloro-3-fluoro-5-nitrobenzonitrile (CAS 1380921-45-8) is a chemical compound with the molecular formula C7H2ClFN2O2 and a molecular weight of 200.55 g/mol. IUPAC name: 4-chloro-3-fluoro-5-nitrobenzonitrile. InChIKey: KKGKVPMYJVOIRR-UHFFFAOYSA-N.
| Molecular formula | C7H2ClFN2O2 |
|---|---|
| Molecular weight | 200.55 g/mol |
| IUPAC name | 4-chloro-3-fluoro-5-nitrobenzonitrile |
| InChIKey | KKGKVPMYJVOIRR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])Cl)F)C#N |
Computed by PubChem (NCBI)