Products 1273597-74-2
CAS 1273597-74-2 is the registry number for Benzenemethanamine, α-cyclopropyl-3-fluoro-4-(trifluoromethoxy)-, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cyclopropyl-[3-fluoro-4-(trifluoromethoxy)phenyl]methanamine (CAS 1273597-74-2) is a chemical compound with the molecular formula C11H11F4NO and a molecular weight of 249.20 g/mol. IUPAC name: cyclopropyl-[3-fluoro-4-(trifluoromethoxy)phenyl]methanamine. InChIKey: YXMOYWFCLHWBFV-UHFFFAOYSA-N.
| Molecular formula | C11H11F4NO |
|---|---|
| Molecular weight | 249.20 g/mol |
| IUPAC name | cyclopropyl-[3-fluoro-4-(trifluoromethoxy)phenyl]methanamine |
| InChIKey | YXMOYWFCLHWBFV-UHFFFAOYSA-N |
| SMILES | C1CC1C(C2=CC(=C(C=C2)OC(F)(F)F)F)N |
Computed by PubChem (NCBI)