Products 1273845-80-9
CAS 1273845-80-9 is the registry number for 4-Nitro-N1-[2-(1-pyrrolidinyl)ethyl]-1,2-benzenediamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-nitro-1-N-(2-pyrrolidin-1-ylethyl)benzene-1,2-diamine (CAS 1273845-80-9) is a chemical compound with the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. IUPAC name: 4-nitro-1-N-(2-pyrrolidin-1-ylethyl)benzene-1,2-diamine. InChIKey: GLFWZKWLXJZSAG-UHFFFAOYSA-N.
| Molecular formula | C12H18N4O2 |
|---|---|
| Molecular weight | 250.30 g/mol |
| IUPAC name | 4-nitro-1-N-(2-pyrrolidin-1-ylethyl)benzene-1,2-diamine |
| InChIKey | GLFWZKWLXJZSAG-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CCNC2=C(C=C(C=C2)[N+](=O)[O-])N |
Computed by PubChem (NCBI)