Products 1273879-49-4
CAS 1273879-49-4 is the registry number for (3-Chlorophenyl)(4-(trifluoromethyl)phenyl)methanamine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3-chlorophenyl)-[4-(trifluoromethyl)phenyl]methanamine (CAS 1273879-49-4) is a chemical compound with the molecular formula C14H11ClF3N and a molecular weight of 285.69 g/mol. IUPAC name: (3-chlorophenyl)-[4-(trifluoromethyl)phenyl]methanamine. InChIKey: YESSYGIEIYUOIL-UHFFFAOYSA-N.
| Molecular formula | C14H11ClF3N |
|---|---|
| Molecular weight | 285.69 g/mol |
| IUPAC name | (3-chlorophenyl)-[4-(trifluoromethyl)phenyl]methanamine |
| InChIKey | YESSYGIEIYUOIL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(C2=CC=C(C=C2)C(F)(F)F)N |
Computed by PubChem (NCBI)