Products 2358751-33-2
CAS 2358751-33-2 is the registry number for (4-Chloro-3-(trifluoromethyl)phenyl)(phenyl)methanamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
[4-chloro-3-(trifluoromethyl)phenyl]-phenylmethanamine (CAS 2358751-33-2) is a chemical compound with the molecular formula C14H11ClF3N and a molecular weight of 285.69 g/mol. IUPAC name: [4-chloro-3-(trifluoromethyl)phenyl]-phenylmethanamine. InChIKey: OUFJEXHZEAQRCL-UHFFFAOYSA-N.
| Molecular formula | C14H11ClF3N |
|---|---|
| Molecular weight | 285.69 g/mol |
| IUPAC name | [4-chloro-3-(trifluoromethyl)phenyl]-phenylmethanamine |
| InChIKey | OUFJEXHZEAQRCL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC(=C(C=C2)Cl)C(F)(F)F)N |
Computed by PubChem (NCBI)