CAS 127413-31-4 appears in our catalog under these names: rac-Flecainide-d3, Flecainide-d3, >95% (HPLC), Flecainide-d3. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 1 mg.
2,4,5-trideuterio-N-(piperidin-2-ylmethyl)-3,6-bis(2,2,2-trifluoroethoxy)benzamide (CAS 127413-31-4) is a chemical compound with the molecular formula C17H20F6N2O3 and a molecular weight of 417.36 g/mol. IUPAC name: 2,4,5-trideuterio-N-(piperidin-2-ylmethyl)-3,6-bis(2,2,2-trifluoroethoxy)benzamide. InChIKey: DJBNUMBKLMJRSA-JZLVSFENSA-N.
| Molecular formula | C17H20F6N2O3 |
|---|---|
| Molecular weight | 417.36 g/mol |
| IUPAC name | 2,4,5-trideuterio-N-(piperidin-2-ylmethyl)-3,6-bis(2,2,2-trifluoroethoxy)benzamide |
| InChIKey | DJBNUMBKLMJRSA-JZLVSFENSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1OCC(F)(F)F)[2H])C(=O)NCC2CCCCN2)OCC(F)(F)F)[2H] |
Computed by PubChem (NCBI)