CAS 1276197-20-6 appears in our catalog under these names: rac-Flecainide-d4, Flecainide-d4, >95% (HPLC), FLECAINIDE-D4. Offered by: Chemat Brand, TRC, Sigma-Aldrich. Available pack sizes: on request, 1mg, 2,5mg, 25mg, 1ML.
2,5-bis(1,1-dideuterio-2,2,2-trifluoroethoxy)-N-(piperidin-2-ylmethyl)benzamide (CAS 1276197-20-6) is a chemical compound with the molecular formula C17H20F6N2O3 and a molecular weight of 418.37 g/mol. IUPAC name: 2,5-bis(1,1-dideuterio-2,2,2-trifluoroethoxy)-N-(piperidin-2-ylmethyl)benzamide. InChIKey: DJBNUMBKLMJRSA-YQUBHJMPSA-N.
| Molecular formula | C17H20F6N2O3 |
|---|---|
| Molecular weight | 418.37 g/mol |
| IUPAC name | 2,5-bis(1,1-dideuterio-2,2,2-trifluoroethoxy)-N-(piperidin-2-ylmethyl)benzamide |
| InChIKey | DJBNUMBKLMJRSA-YQUBHJMPSA-N |
| SMILES | [2H]C([2H])(C(F)(F)F)OC1=CC(=C(C=C1)OC([2H])([2H])C(F)(F)F)C(=O)NCC2CCCCN2 |
Computed by PubChem (NCBI)