CAS 1274702-35-0 is the registry number for 9-(4-Bromophenyl)-10-phenylphenanthrene, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
9-(4-bromophenyl)-10-phenylphenanthrene (CAS 1274702-35-0) is a chemical compound with the molecular formula C26H17Br and a molecular weight of 409.3 g/mol. IUPAC name: 9-(4-bromophenyl)-10-phenylphenanthrene. InChIKey: KXPFJAIKSHJVTM-UHFFFAOYSA-N.
| Molecular formula | C26H17Br |
|---|---|
| Molecular weight | 409.3 g/mol |
| IUPAC name | 9-(4-bromophenyl)-10-phenylphenanthrene |
| InChIKey | KXPFJAIKSHJVTM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C3=CC=CC=C3C4=CC=CC=C42)C5=CC=C(C=C5)Br |
Computed by PubChem (NCBI)