CAS 173678-07-4 is the registry number for 1,1'-(5-Bromo-1,3-phenylene)dinaphthalene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-bromo-5-naphthalen-1-ylphenyl)naphthalene (CAS 173678-07-4) is a chemical compound with the molecular formula C26H17Br and a molecular weight of 409.3 g/mol. IUPAC name: 1-(3-bromo-5-naphthalen-1-ylphenyl)naphthalene. InChIKey: NONAXDUZMZACEC-UHFFFAOYSA-N.
| Molecular formula | C26H17Br |
|---|---|
| Molecular weight | 409.3 g/mol |
| IUPAC name | 1-(3-bromo-5-naphthalen-1-ylphenyl)naphthalene |
| InChIKey | NONAXDUZMZACEC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=CC(=CC(=C3)Br)C4=CC=CC5=CC=CC=C54 |
Computed by PubChem (NCBI)