CAS 1274891-82-5 is the registry number for Cis-3-benzylaminocyclobutanecarboxylic acid tfa (1:1), 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
3-(benzylamino)cyclobutane-1-carboxylic acid;2,2,2-trifluoroacetic acid (CAS 1274891-82-5) is a chemical compound with the molecular formula C14H16F3NO4 and a molecular weight of 319.28 g/mol. IUPAC name: 3-(benzylamino)cyclobutane-1-carboxylic acid;2,2,2-trifluoroacetic acid. InChIKey: HMMPJTLENADFTA-UHFFFAOYSA-N.
| Molecular formula | C14H16F3NO4 |
|---|---|
| Molecular weight | 319.28 g/mol |
| IUPAC name | 3-(benzylamino)cyclobutane-1-carboxylic acid;2,2,2-trifluoroacetic acid |
| InChIKey | HMMPJTLENADFTA-UHFFFAOYSA-N |
| SMILES | C1C(CC1NCC2=CC=CC=C2)C(=O)O.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)