Products 1274891-82-5

CAS 1274891-82-5 is the registry number for Cis-3-benzylaminocyclobutanecarboxylic acid tfa (1:1), 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(benzylamino)cyclobutane-1-carboxylic acid;2,2,2-trifluoroacetic acid (CAS 1274891-82-5) is a chemical compound with the molecular formula C14H16F3NO4 and a molecular weight of 319.28 g/mol. IUPAC name: 3-(benzylamino)cyclobutane-1-carboxylic acid;2,2,2-trifluoroacetic acid. InChIKey: HMMPJTLENADFTA-UHFFFAOYSA-N.

Identity
Molecular formulaC14H16F3NO4
Molecular weight319.28 g/mol
IUPAC name3-(benzylamino)cyclobutane-1-carboxylic acid;2,2,2-trifluoroacetic acid
InChIKeyHMMPJTLENADFTA-UHFFFAOYSA-N
SMILESC1C(CC1NCC2=CC=CC=C2)C(=O)O.C(=O)(C(F)(F)F)O

Computed by PubChem (NCBI)