CAS 205445-54-1 appears in our catalog under these names: Boc-L-3,4,5-trifluorophenylalanine, 98%, (S)-2-((tert-Butoxycarbonyl)amino)-3-(3,4,5-trifluorophenyl)propanoic acid, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3,4,5-trifluorophenyl)propanoic acid (CAS 205445-54-1) is a chemical compound with the molecular formula C14H16F3NO4 and a molecular weight of 319.28 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3,4,5-trifluorophenyl)propanoic acid. InChIKey: CWPLICWOIFEQMR-JTQLQIEISA-N.
| Molecular formula | C14H16F3NO4 |
|---|---|
| Molecular weight | 319.28 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3,4,5-trifluorophenyl)propanoic acid |
| InChIKey | CWPLICWOIFEQMR-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC(=C(C(=C1)F)F)F)C(=O)O |
Computed by PubChem (NCBI)