Products 1274892-27-1
CAS 1274892-27-1 is the registry number for 2-bromo-5,5-dimethyl-3-((2-nitrophenyl)amino)cyclohex-2-en-1-one. Offered by: Biosynth. Available pack sizes: 250mg.
2-bromo-5,5-dimethyl-3-(2-nitroanilino)cyclohex-2-en-1-one (CAS 1274892-27-1) is a chemical compound with the molecular formula C14H15BrN2O3 and a molecular weight of 339.18 g/mol. IUPAC name: 2-bromo-5,5-dimethyl-3-(2-nitroanilino)cyclohex-2-en-1-one. InChIKey: WVRCPBAGPOWMPB-UHFFFAOYSA-N.
| Molecular formula | C14H15BrN2O3 |
|---|---|
| Molecular weight | 339.18 g/mol |
| IUPAC name | 2-bromo-5,5-dimethyl-3-(2-nitroanilino)cyclohex-2-en-1-one |
| InChIKey | WVRCPBAGPOWMPB-UHFFFAOYSA-N |
| SMILES | CC1(CC(=C(C(=O)C1)Br)NC2=CC=CC=C2[N+](=O)[O-])C |
Computed by PubChem (NCBI)