CAS 2767425-52-3 is the registry number for tert-Butyl 6-bromo-1-methyl-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 6-bromo-1-methyl-4-oxo-1,8-naphthyridine-3-carboxylate (CAS 2767425-52-3) is a chemical compound with the molecular formula C14H15BrN2O3 and a molecular weight of 339.18 g/mol. IUPAC name: tert-butyl 6-bromo-1-methyl-4-oxo-1,8-naphthyridine-3-carboxylate. InChIKey: RGQXGOZHDKJZJJ-UHFFFAOYSA-N.
| Molecular formula | C14H15BrN2O3 |
|---|---|
| Molecular weight | 339.18 g/mol |
| IUPAC name | tert-butyl 6-bromo-1-methyl-4-oxo-1,8-naphthyridine-3-carboxylate |
| InChIKey | RGQXGOZHDKJZJJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CN(C2=C(C1=O)C=C(C=N2)Br)C |
Computed by PubChem (NCBI)