Products 1274948-39-8
CAS 1274948-39-8 is the registry number for 3-(3,4-dimethoxyphenyl)-4-(hydroxyimino)-1-methylindeno(2,3-d)pyrazole. Offered by: Biosynth. Available pack sizes: 250mg.
3-(3,4-dimethoxyphenyl)-1-methyl-4-nitroso-2H-indeno[1,2-c]pyrazole (CAS 1274948-39-8) is a chemical compound with the molecular formula C19H17N3O3 and a molecular weight of 335.4 g/mol. IUPAC name: 3-(3,4-dimethoxyphenyl)-1-methyl-4-nitroso-2H-indeno[1,2-c]pyrazole. InChIKey: FLEJJXGOTWIJLH-UHFFFAOYSA-N.
| Molecular formula | C19H17N3O3 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 3-(3,4-dimethoxyphenyl)-1-methyl-4-nitroso-2H-indeno[1,2-c]pyrazole |
| InChIKey | FLEJJXGOTWIJLH-UHFFFAOYSA-N |
| SMILES | CN1C2=C3C=CC=CC3=C(C2=C(N1)C4=CC(=C(C=C4)OC)OC)N=O |
Computed by PubChem (NCBI)