Products 1275068-12-6
CAS 1275068-12-6 is the registry number for N-((5-Methylisoxazol-3-yl)methyl)-4-(trifluoromethyl)aniline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(5-methyl-1,2-oxazol-3-yl)methyl]-4-(trifluoromethyl)aniline (CAS 1275068-12-6) is a chemical compound with the molecular formula C12H11F3N2O and a molecular weight of 256.22 g/mol. IUPAC name: N-[(5-methyl-1,2-oxazol-3-yl)methyl]-4-(trifluoromethyl)aniline. InChIKey: SAJCHBORZWRTPO-UHFFFAOYSA-N.
| Molecular formula | C12H11F3N2O |
|---|---|
| Molecular weight | 256.22 g/mol |
| IUPAC name | N-[(5-methyl-1,2-oxazol-3-yl)methyl]-4-(trifluoromethyl)aniline |
| InChIKey | SAJCHBORZWRTPO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)CNC2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)