Products 328947-81-5
CAS 328947-81-5 is the registry number for 6–(Dimethylamino)–4–(trifluoromethyl)–2(1H)–quinolinone. Offered by: GLPBio. Available pack sizes: 10mg.
6-(dimethylamino)-4-(trifluoromethyl)-1H-quinolin-2-one (CAS 328947-81-5) is a chemical compound with the molecular formula C12H11F3N2O and a molecular weight of 256.22 g/mol. IUPAC name: 6-(dimethylamino)-4-(trifluoromethyl)-1H-quinolin-2-one. InChIKey: JDXONFGBSUBGTN-UHFFFAOYSA-N.
| Molecular formula | C12H11F3N2O |
|---|---|
| Molecular weight | 256.22 g/mol |
| IUPAC name | 6-(dimethylamino)-4-(trifluoromethyl)-1H-quinolin-2-one |
| InChIKey | JDXONFGBSUBGTN-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)NC(=O)C=C2C(F)(F)F |
Computed by PubChem (NCBI)