Products 1275614-81-7

CAS 1275614-81-7 is the registry number for 6-Fluoro-3-methyl-1H-indole-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

6-fluoro-3-methyl-1H-indole-2-carboxylic acid (CAS 1275614-81-7) is a chemical compound with the molecular formula C10H8FNO2 and a molecular weight of 193.17 g/mol. IUPAC name: 6-fluoro-3-methyl-1H-indole-2-carboxylic acid. InChIKey: JGKANEPHGWFOOH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8FNO2
Molecular weight193.17 g/mol
IUPAC name6-fluoro-3-methyl-1H-indole-2-carboxylic acid
InChIKeyJGKANEPHGWFOOH-UHFFFAOYSA-N
SMILESCC1=C(NC2=C1C=CC(=C2)F)C(=O)O

Computed by PubChem (NCBI)