CAS 1276056-91-7 appears in our catalog under these names: Sodium 17beta-Dihydroequilenin-4,16,16-d3 3-Sulfate (Stabilized with TRIS, 50% w/w), 98 atom % D, min 98% Chemical Purity, 17β-Dihydroequilenin 3-sulfate-4,16,16-d3 (sodium). Offered by: CDN, MedChemExpress. Available pack sizes: 0,02g, 0,01g, 1mg, 5mg.
Sodium [(17S)-4,16,16-trideuterio-17-hydroxy-13-methyl-12,14,15,17-tetrahydro-11H-cyclopenta[a]phenanthren-3-yl] sulfate (CAS 1276056-91-7) is a chemical compound with the molecular formula C18H19NaO5S and a molecular weight of 373.4 g/mol. IUPAC name: sodium [(17S)-4,16,16-trideuterio-17-hydroxy-13-methyl-12,14,15,17-tetrahydro-11H-cyclopenta[a]phenanthren-3-yl] sulfate. InChIKey: HBVSSZJQFZAJLK-MPYZXJRPSA-M.
| Molecular formula | C18H19NaO5S |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | sodium [(17S)-4,16,16-trideuterio-17-hydroxy-13-methyl-12,14,15,17-tetrahydro-11H-cyclopenta[a]phenanthren-3-yl] sulfate |
| InChIKey | HBVSSZJQFZAJLK-MPYZXJRPSA-M |
| SMILES | [2H]C1=C(C=CC2=C1C=CC3=C2CCC4(C3CC([C@@H]4O)([2H])[2H])C)OS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)