CAS 1276197-13-7 is the registry number for Ritalinic-d9 Acid HCl (piperidine-d9) (mixture of stereoisomers), 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,01g.
2-(2,3,3,4,4,5,5,6,6-nonadeuteriopiperidin-2-yl)-2-phenylacetic acid;hydrochloride (CAS 1276197-13-7) is a chemical compound with the molecular formula C13H18ClNO2 and a molecular weight of 264.79 g/mol. IUPAC name: 2-(2,3,3,4,4,5,5,6,6-nonadeuteriopiperidin-2-yl)-2-phenylacetic acid;hydrochloride. InChIKey: SCUMDQFFZZGUQY-AVBISFGISA-N.
| Molecular formula | C13H18ClNO2 |
|---|---|
| Molecular weight | 264.79 g/mol |
| IUPAC name | 2-(2,3,3,4,4,5,5,6,6-nonadeuteriopiperidin-2-yl)-2-phenylacetic acid;hydrochloride |
| InChIKey | SCUMDQFFZZGUQY-AVBISFGISA-N |
| SMILES | [2H]C1(C(C(NC(C1([2H])[2H])([2H])C(C2=CC=CC=C2)C(=O)O)([2H])[2H])([2H])[2H])[2H].Cl |
Computed by PubChem (NCBI)