Products 1276197-16-0

CAS 1276197-16-0 is the registry number for 4-Nitrotoluene-2,3,5,6-d4, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.

Structural formula: {0} (CAS {1})

1,2,4,5-tetradeuterio-3-methyl-6-nitrobenzene (CAS 1276197-16-0) is a chemical compound with the molecular formula C7H7NO2 and a molecular weight of 141.16 g/mol. IUPAC name: 1,2,4,5-tetradeuterio-3-methyl-6-nitrobenzene. InChIKey: ZPTVNYMJQHSSEA-QFFDRWTDSA-N.

Identity
Molecular formulaC7H7NO2
Molecular weight141.16 g/mol
IUPAC name1,2,4,5-tetradeuterio-3-methyl-6-nitrobenzene
InChIKeyZPTVNYMJQHSSEA-QFFDRWTDSA-N
SMILES[2H]C1=C(C(=C(C(=C1C)[2H])[2H])[N+](=O)[O-])[2H]

Computed by PubChem (NCBI)