CAS 23346-24-9 is the registry number for 4-Nitrotoluene-alpha,alpha,alpha-d3, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.
1-nitro-4-(trideuteriomethyl)benzene (CAS 23346-24-9) is a chemical compound with the molecular formula C7H7NO2 and a molecular weight of 140.15 g/mol. IUPAC name: 1-nitro-4-(trideuteriomethyl)benzene. InChIKey: ZPTVNYMJQHSSEA-FIBGUPNXSA-N.
| Molecular formula | C7H7NO2 |
|---|---|
| Molecular weight | 140.15 g/mol |
| IUPAC name | 1-nitro-4-(trideuteriomethyl)benzene |
| InChIKey | ZPTVNYMJQHSSEA-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)