Products 23346-24-9

CAS 23346-24-9 is the registry number for 4-Nitrotoluene-alpha,alpha,alpha-d3, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.

Structural formula: {0} (CAS {1})

1-nitro-4-(trideuteriomethyl)benzene (CAS 23346-24-9) is a chemical compound with the molecular formula C7H7NO2 and a molecular weight of 140.15 g/mol. IUPAC name: 1-nitro-4-(trideuteriomethyl)benzene. InChIKey: ZPTVNYMJQHSSEA-FIBGUPNXSA-N.

Identity
Molecular formulaC7H7NO2
Molecular weight140.15 g/mol
IUPAC name1-nitro-4-(trideuteriomethyl)benzene
InChIKeyZPTVNYMJQHSSEA-FIBGUPNXSA-N
SMILES[2H]C([2H])([2H])C1=CC=C(C=C1)[N+](=O)[O-]

Computed by PubChem (NCBI)