Products 1276197-31-9

CAS 1276197-31-9 appears in our catalog under these names: N-(3-Methylcrotonyl)glycine-2,2-d2, 98 atom % D, min 98% Chemical Purity, 3-Methylcrotonylglycine-d2. Offered by: CDN, MedChemExpress. Available pack sizes: 0,05g, 0,01g, 1mg, 5mg.

Structural formula: {0} (CAS {1})

2,2-dideuterio-2-(3-methylbut-2-enoylamino)acetic acid (CAS 1276197-31-9) is a chemical compound with the molecular formula C7H11NO3 and a molecular weight of 159.18 g/mol. IUPAC name: 2,2-dideuterio-2-(3-methylbut-2-enoylamino)acetic acid. InChIKey: PFWQSHXPNKRLIV-APZFVMQVSA-N.

Identity
Molecular formulaC7H11NO3
Molecular weight159.18 g/mol
IUPAC name2,2-dideuterio-2-(3-methylbut-2-enoylamino)acetic acid
InChIKeyPFWQSHXPNKRLIV-APZFVMQVSA-N
SMILES[2H]C([2H])(C(=O)O)NC(=O)C=C(C)C

Computed by PubChem (NCBI)