Products 1276197-39-7
CAS 1276197-39-7 appears in our catalog under these names: alpha-Hydroxymetoprolol-d7 (iso-propyl-d7) (mixture of stereoisomers), 99 atom % D, min 98% Chemical Purity, α-Hydroxymetoprolol-d7, 99.09%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 1 mg.
1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-[4-(1-hydroxy-2-methoxyethyl)phenoxy]propan-2-ol (CAS 1276197-39-7) is a chemical compound with the molecular formula C15H25NO4 and a molecular weight of 290.41 g/mol. IUPAC name: 1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-[4-(1-hydroxy-2-methoxyethyl)phenoxy]propan-2-ol. InChIKey: OFRYBPCSEMMZHR-UENXPIBQSA-N.
| Molecular formula | C15H25NO4 |
|---|---|
| Molecular weight | 290.41 g/mol |
| IUPAC name | 1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-[4-(1-hydroxy-2-methoxyethyl)phenoxy]propan-2-ol |
| InChIKey | OFRYBPCSEMMZHR-UENXPIBQSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NCC(COC1=CC=C(C=C1)C(COC)O)O |
Computed by PubChem (NCBI)