Products 1276197-41-1
CAS 1276197-41-1 is the registry number for 2-Nitroaniline-4,6-d2, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.
2,4-dideuterio-6-nitroaniline (CAS 1276197-41-1) is a chemical compound with the molecular formula C6H6N2O2 and a molecular weight of 140.14 g/mol. IUPAC name: 2,4-dideuterio-6-nitroaniline. InChIKey: DPJCXCZTLWNFOH-PBNXXWCMSA-N.
| Molecular formula | C6H6N2O2 |
|---|---|
| Molecular weight | 140.14 g/mol |
| IUPAC name | 2,4-dideuterio-6-nitroaniline |
| InChIKey | DPJCXCZTLWNFOH-PBNXXWCMSA-N |
| SMILES | [2H]C1=CC(=C(C(=C1)[N+](=O)[O-])N)[2H] |
Computed by PubChem (NCBI)