CAS 204244-80-4 is the registry number for 2-Nitroaniline-3,4,5,6-d4, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,1g, 0,05g.
2,3,4,5-tetradeuterio-6-nitroaniline (CAS 204244-80-4) is a chemical compound with the molecular formula C6H6N2O2 and a molecular weight of 142.15 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-nitroaniline. InChIKey: DPJCXCZTLWNFOH-RHQRLBAQSA-N.
| Molecular formula | C6H6N2O2 |
|---|---|
| Molecular weight | 142.15 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-nitroaniline |
| InChIKey | DPJCXCZTLWNFOH-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])N)[N+](=O)[O-])[2H])[2H] |
Computed by PubChem (NCBI)