Products 204244-80-4

CAS 204244-80-4 is the registry number for 2-Nitroaniline-3,4,5,6-d4, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,1g, 0,05g.

Structural formula: {0} (CAS {1})

2,3,4,5-tetradeuterio-6-nitroaniline (CAS 204244-80-4) is a chemical compound with the molecular formula C6H6N2O2 and a molecular weight of 142.15 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-nitroaniline. InChIKey: DPJCXCZTLWNFOH-RHQRLBAQSA-N.

Identity
Molecular formulaC6H6N2O2
Molecular weight142.15 g/mol
IUPAC name2,3,4,5-tetradeuterio-6-nitroaniline
InChIKeyDPJCXCZTLWNFOH-RHQRLBAQSA-N
SMILES[2H]C1=C(C(=C(C(=C1[2H])N)[N+](=O)[O-])[2H])[2H]

Computed by PubChem (NCBI)