Products 1276197-49-9
CAS 1276197-49-9 is the registry number for D-Propoxyphene-d5 HCl (propionyl-d5), 97 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,1g, 0,05g.
[(2S,3R)-4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-yl] 2,2,3,3,3-pentadeuteriopropanoate;hydrochloride (CAS 1276197-49-9) is a chemical compound with the molecular formula C22H30ClNO2 and a molecular weight of 381.0 g/mol. IUPAC name: [(2S,3R)-4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-yl] 2,2,3,3,3-pentadeuteriopropanoate;hydrochloride. InChIKey: QMQBBUPJKANITL-RSLWSOLFSA-N.
| Molecular formula | C22H30ClNO2 |
|---|---|
| Molecular weight | 381.0 g/mol |
| IUPAC name | [(2S,3R)-4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-yl] 2,2,3,3,3-pentadeuteriopropanoate;hydrochloride |
| InChIKey | QMQBBUPJKANITL-RSLWSOLFSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C(=O)O[C@](CC1=CC=CC=C1)(C2=CC=CC=C2)[C@H](C)CN(C)C.Cl |
Computed by PubChem (NCBI)
Synonyms:
D-Propoxyphene-d5 HCl (propionyl-d5)