Products 2714408-83-8
CAS 2714408-83-8 is the registry number for L-Propoxyphene-d5 HCl (propionyl-d5), 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,05g, 0,01g.
[(2R,3S)-4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-yl] 2,2,3,3,3-pentadeuteriopropanoate;hydrochloride (CAS 2714408-83-8) is a chemical compound with the molecular formula C22H30ClNO2 and a molecular weight of 381.0 g/mol. IUPAC name: [(2R,3S)-4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-yl] 2,2,3,3,3-pentadeuteriopropanoate;hydrochloride. InChIKey: QMQBBUPJKANITL-HYOVGAQCSA-N.
| Molecular formula | C22H30ClNO2 |
|---|---|
| Molecular weight | 381.0 g/mol |
| IUPAC name | [(2R,3S)-4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-yl] 2,2,3,3,3-pentadeuteriopropanoate;hydrochloride |
| InChIKey | QMQBBUPJKANITL-HYOVGAQCSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C(=O)O[C@@](CC1=CC=CC=C1)(C2=CC=CC=C2)[C@@H](C)CN(C)C.Cl |
Computed by PubChem (NCBI)
Synonyms:
L-Propoxyphene-d5 HCl (propionyl-d5)