CAS 1276434-31-1 is the registry number for 1-ethyl-4-(3-nitropyridin-2-yl)piperazine. Offered by: Chemat. Available pack sizes: 1g.
1-ethyl-4-(3-nitro-2-pyridinyl)piperazine (CAS 1276434-31-1) is a chemical compound with the molecular formula C11H16N4O2 and a molecular weight of 236.27 g/mol. IUPAC name: 1-ethyl-4-(3-nitro-2-pyridinyl)piperazine. InChIKey: LBRKOEWNCPYABP-UHFFFAOYSA-N.
| Molecular formula | C11H16N4O2 |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | 1-ethyl-4-(3-nitro-2-pyridinyl)piperazine |
| InChIKey | LBRKOEWNCPYABP-UHFFFAOYSA-N |
| SMILES | CCN1CCN(CC1)C2=C(C=CC=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)