CAS 127657-45-8 appears in our catalog under these names: Minodronic Acid Impurity 2, Minodronic Acid Impurity 11, Minodronic Acid Impurity 2-d4. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(1-hydroxy-2-imidazo[1,2-a]pyridin-2-yl-1-phosphonoethyl)phosphonic acid (CAS 127657-45-8) is a chemical compound with the molecular formula C9H12N2O7P2 and a molecular weight of 322.15 g/mol. IUPAC name: (1-hydroxy-2-imidazo[1,2-a]pyridin-2-yl-1-phosphonoethyl)phosphonic acid. InChIKey: GSWUBXXDSFSFSY-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O7P2 |
|---|---|
| Molecular weight | 322.15 g/mol |
| IUPAC name | (1-hydroxy-2-imidazo[1,2-a]pyridin-2-yl-1-phosphonoethyl)phosphonic acid |
| InChIKey | GSWUBXXDSFSFSY-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C=C1)CC(O)(P(=O)(O)O)P(=O)(O)O |
Computed by PubChem (NCBI)